C16H17F3N4OS — CID 126796102
N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-3-[4-(trifluoromethyl)phenyl]but-2-enamide (PubChem CID 126796102) has the molecular formula C16H17F3N4OS and a molecular weight of 370.40 g/mol. Its IUPAC name is N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-3-[4-(trifluoromethyl)phenyl]but-2-enamide.
| Compound Name | N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-3-[4-(trifluoromethyl)phenyl]but-2-enamide |
|---|---|
| PubChem CID | 126796102 |
| Molecular Formula | C16H17F3N4OS |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-3-[4-(trifluoromethyl)phenyl]but-2-enamide |
| SMILES | CC(=CC(=O)NCCc1n[nH]c(=S)n1C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H17F3N4OS/c1-10(11-3-5-12(6-4-11)16(17,18)19)9-14(24)20-8-7-13-21-22-15(25)23(13)2/h3-6,9H,7-8H2,1-2H3,(H,20,24)(H,22,25) |
| InChIKey | MJPJOUWCXRCBGB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|