C16H19N5OS — CID 126810672
N-[2-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-3-pyridin-4-ylbut-2-enamide (PubChem CID 126810672) has the molecular formula C16H19N5OS and a molecular weight of 329.43 g/mol. Its IUPAC name is N-[2-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-3-pyridin-4-ylbut-2-enamide.
| Compound Name | N-[2-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-3-pyridin-4-ylbut-2-enamide |
|---|---|
| PubChem CID | 126810672 |
| Molecular Formula | C16H19N5OS |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | N-[2-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]-3-pyridin-4-ylbut-2-enamide |
| SMILES | CC(=CC(=O)NCCn1c(C2CC2)n[nH]c1=S)c1ccncc1 |
| InChI | InChI=1S/C16H19N5OS/c1-11(12-4-6-17-7-5-12)10-14(22)18-8-9-21-15(13-2-3-13)19-20-16(21)23/h4-7,10,13H,2-3,8-9H2,1H3,(H,18,22)(H,20,23) |
| InChIKey | DJJAEVGEAZMUAD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|