C16H16N6O2S — CID 75443473
N'-(3-cyanophenyl)-N-[2-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]oxamide (PubChem CID 75443473) has the molecular formula C16H16N6O2S and a molecular weight of 356.41 g/mol. Its IUPAC name is N'-(3-cyanophenyl)-N-[2-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]oxamide.
| Compound Name | N'-(3-cyanophenyl)-N-[2-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 75443473 |
| Molecular Formula | C16H16N6O2S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | N'-(3-cyanophenyl)-N-[2-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl]oxamide |
| SMILES | N#Cc1cccc(NC(=O)C(=O)NCCn2c(C3CC3)n[nH]c2=S)c1 |
| InChI | InChI=1S/C16H16N6O2S/c17-9-10-2-1-3-12(8-10)19-15(24)14(23)18-6-7-22-13(11-4-5-11)20-21-16(22)25/h1-3,8,11H,4-7H2,(H,18,23)(H,19,24)(H,21,25) |
| InChIKey | UUIFVDQVQXKZDO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 115.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|