C15H16F2N4O2S — CID 132970136
(E)-3-[2-(difluoromethoxy)phenyl]-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]but-2-enamide (PubChem CID 132970136) has the molecular formula C15H16F2N4O2S and a molecular weight of 354.38 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)phenyl]-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]but-2-enamide.
| Compound Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]but-2-enamide |
|---|---|
| PubChem CID | 132970136 |
| Molecular Formula | C15H16F2N4O2S |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]but-2-enamide |
| SMILES | C/C(=C\C(=O)NCc1n[nH]c(=S)n1C)c1ccccc1OC(F)F |
| InChI | InChI=1S/C15H16F2N4O2S/c1-9(10-5-3-4-6-11(10)23-14(16)17)7-13(22)18-8-12-19-20-15(24)21(12)2/h3-7,14H,8H2,1-2H3,(H,18,22)(H,20,24)/b9-7+ |
| InChIKey | BPVZKSPOONTEJQ-VQHVLOKHSA-N |
| XLogP | 2.80 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|