C20H18N6O2S — CID 56577172
3-benzyl-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-4-oxophthalazine-1-carboxamide (PubChem CID 56577172) has the molecular formula C20H18N6O2S and a molecular weight of 406.47 g/mol. Its IUPAC name is 3-benzyl-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-4-oxophthalazine-1-carboxamide.
| Compound Name | 3-benzyl-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 56577172 |
| Molecular Formula | C20H18N6O2S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 3-benzyl-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-4-oxophthalazine-1-carboxamide |
| SMILES | Cn1c(CNC(=O)c2nn(Cc3ccccc3)c(=O)c3ccccc23)n[nH]c1=S |
| InChI | InChI=1S/C20H18N6O2S/c1-25-16(22-23-20(25)29)11-21-18(27)17-14-9-5-6-10-15(14)19(28)26(24-17)12-13-7-3-2-4-8-13/h2-10H,11-12H2,1H3,(H,21,27)(H,23,29) |
| InChIKey | DAKSUVNTIBPFAO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|