C19H15N5O4 — CID 32905584
3-benzyl-N-(2,4-dioxoimidazolidin-1-yl)-4-oxophthalazine-1-carboxamide (PubChem CID 32905584) has the molecular formula C19H15N5O4 and a molecular weight of 377.36 g/mol. Its IUPAC name is 3-benzyl-N-(2,4-dioxoimidazolidin-1-yl)-4-oxophthalazine-1-carboxamide.
| Compound Name | 3-benzyl-N-(2,4-dioxoimidazolidin-1-yl)-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 32905584 |
| Molecular Formula | C19H15N5O4 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 3-benzyl-N-(2,4-dioxoimidazolidin-1-yl)-4-oxophthalazine-1-carboxamide |
| SMILES | O=C1CN(NC(=O)c2nn(Cc3ccccc3)c(=O)c3ccccc23)C(=O)N1 |
| InChI | InChI=1S/C19H15N5O4/c25-15-11-24(19(28)20-15)22-17(26)16-13-8-4-5-9-14(13)18(27)23(21-16)10-12-6-2-1-3-7-12/h1-9H,10-11H2,(H,22,26)(H,20,25,28) |
| InChIKey | MGLXLQBRNAHAQB-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|