C14H17FN4OS — CID 95178695
2-(2-fluorophenyl)-2-methyl-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]propanamide (PubChem CID 95178695) has the molecular formula C14H17FN4OS and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-2-methyl-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]propanamide.
| Compound Name | 2-(2-fluorophenyl)-2-methyl-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]propanamide |
|---|---|
| PubChem CID | 95178695 |
| Molecular Formula | C14H17FN4OS |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 2-(2-fluorophenyl)-2-methyl-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]propanamide |
| SMILES | Cn1c(CNC(=O)C(C)(C)c2ccccc2F)n[nH]c1=S |
| InChI | InChI=1S/C14H17FN4OS/c1-14(2,9-6-4-5-7-10(9)15)12(20)16-8-11-17-18-13(21)19(11)3/h4-7H,8H2,1-3H3,(H,16,20)(H,18,21) |
| InChIKey | BOUQLBWUFZSJKV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|