C17H23F2NO3 — CID 111970449
(Z)-3-[2-(difluoromethoxy)phenyl]-N-(4-hydroxy-2-methylpentyl)but-2-enamide (PubChem CID 111970449) has the molecular formula C17H23F2NO3 and a molecular weight of 327.37 g/mol. Its IUPAC name is (Z)-3-[2-(difluoromethoxy)phenyl]-N-(4-hydroxy-2-methylpentyl)but-2-enamide.
| Compound Name | (Z)-3-[2-(difluoromethoxy)phenyl]-N-(4-hydroxy-2-methylpentyl)but-2-enamide |
|---|---|
| PubChem CID | 111970449 |
| Molecular Formula | C17H23F2NO3 |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (Z)-3-[2-(difluoromethoxy)phenyl]-N-(4-hydroxy-2-methylpentyl)but-2-enamide |
| SMILES | C/C(=C/C(=O)NCC(C)CC(C)O)c1ccccc1OC(F)F |
| InChI | InChI=1S/C17H23F2NO3/c1-11(8-13(3)21)10-20-16(22)9-12(2)14-6-4-5-7-15(14)23-17(18)19/h4-7,9,11,13,17,21H,8,10H2,1-3H3,(H,20,22)/b12-9- |
| InChIKey | PXWLBNYDYYYKDI-XFXZXTDPSA-N |
| XLogP | 3.21 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|