C17H22F3NO2 — CID 111447585
N-(4-hydroxy-2-methylpentyl)-3-[4-(trifluoromethyl)phenyl]but-2-enamide (PubChem CID 111447585) has the molecular formula C17H22F3NO2 and a molecular weight of 329.36 g/mol. Its IUPAC name is N-(4-hydroxy-2-methylpentyl)-3-[4-(trifluoromethyl)phenyl]but-2-enamide.
| Compound Name | N-(4-hydroxy-2-methylpentyl)-3-[4-(trifluoromethyl)phenyl]but-2-enamide |
|---|---|
| PubChem CID | 111447585 |
| Molecular Formula | C17H22F3NO2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | N-(4-hydroxy-2-methylpentyl)-3-[4-(trifluoromethyl)phenyl]but-2-enamide |
| SMILES | CC(=CC(=O)NCC(C)CC(C)O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H22F3NO2/c1-11(8-13(3)22)10-21-16(23)9-12(2)14-4-6-15(7-5-14)17(18,19)20/h4-7,9,11,13,22H,8,10H2,1-3H3,(H,21,23) |
| InChIKey | UHQMGXVXEPXPAN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|