C16H23NO2 — CID 111447673
N-(4-hydroxy-2-methylpentyl)-3-(4-methylphenyl)prop-2-enamide (PubChem CID 111447673) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is N-(4-hydroxy-2-methylpentyl)-3-(4-methylphenyl)prop-2-enamide.
| Compound Name | N-(4-hydroxy-2-methylpentyl)-3-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 111447673 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N-(4-hydroxy-2-methylpentyl)-3-(4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(C=CC(=O)NCC(C)CC(C)O)cc1 |
| InChI | InChI=1S/C16H23NO2/c1-12-4-6-15(7-5-12)8-9-16(19)17-11-13(2)10-14(3)18/h4-9,13-14,18H,10-11H2,1-3H3,(H,17,19) |
| InChIKey | JBGHCFIHZUEURM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|