C16H21FN2O3 — CID 110007312
(E)-N'-(4-fluorophenyl)-N-(4-hydroxy-2-methylpentyl)but-2-enediamide (PubChem CID 110007312) has the molecular formula C16H21FN2O3 and a molecular weight of 308.35 g/mol. Its IUPAC name is (E)-N'-(4-fluorophenyl)-N-(4-hydroxy-2-methylpentyl)but-2-enediamide.
| Compound Name | (E)-N'-(4-fluorophenyl)-N-(4-hydroxy-2-methylpentyl)but-2-enediamide |
|---|---|
| PubChem CID | 110007312 |
| Molecular Formula | C16H21FN2O3 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (E)-N'-(4-fluorophenyl)-N-(4-hydroxy-2-methylpentyl)but-2-enediamide |
| SMILES | CC(O)CC(C)CNC(=O)/C=C/C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C16H21FN2O3/c1-11(9-12(2)20)10-18-15(21)7-8-16(22)19-14-5-3-13(17)4-6-14/h3-8,11-12,20H,9-10H2,1-2H3,(H,18,21)(H,19,22)/b8-7+ |
| InChIKey | LYSBDKHRKMLDJG-BQYQJAHWSA-N |
| XLogP | 1.84 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|