C17H22F3NO3 — CID 110003158
(Z)-N-(4-hydroxy-1-methoxy-2-methylbutan-2-yl)-3-[4-(trifluoromethyl)phenyl]but-2-enamide (PubChem CID 110003158) has the molecular formula C17H22F3NO3 and a molecular weight of 345.36 g/mol. Its IUPAC name is (Z)-N-(4-hydroxy-1-methoxy-2-methylbutan-2-yl)-3-[4-(trifluoromethyl)phenyl]but-2-enamide.
| Compound Name | (Z)-N-(4-hydroxy-1-methoxy-2-methylbutan-2-yl)-3-[4-(trifluoromethyl)phenyl]but-2-enamide |
|---|---|
| PubChem CID | 110003158 |
| Molecular Formula | C17H22F3NO3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | (Z)-N-(4-hydroxy-1-methoxy-2-methylbutan-2-yl)-3-[4-(trifluoromethyl)phenyl]but-2-enamide |
| SMILES | COCC(C)(CCO)NC(=O)/C=C(/C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H22F3NO3/c1-12(13-4-6-14(7-5-13)17(18,19)20)10-15(23)21-16(2,8-9-22)11-24-3/h4-7,10,22H,8-9,11H2,1-3H3,(H,21,23)/b12-10- |
| InChIKey | VXGQAUSWUFIPKD-BENRWUELSA-N |
| XLogP | 3.01 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|