C18H22F3N3O2 — CID 51129462
(Z)-N-[1-(2-amino-2-oxoethyl)piperidin-4-yl]-3-[4-(trifluoromethyl)phenyl]but-2-enamide (PubChem CID 51129462) has the molecular formula C18H22F3N3O2 and a molecular weight of 369.39 g/mol. Its IUPAC name is (Z)-N-[1-(2-amino-2-oxoethyl)piperidin-4-yl]-3-[4-(trifluoromethyl)phenyl]but-2-enamide.
| Compound Name | (Z)-N-[1-(2-amino-2-oxoethyl)piperidin-4-yl]-3-[4-(trifluoromethyl)phenyl]but-2-enamide |
|---|---|
| PubChem CID | 51129462 |
| Molecular Formula | C18H22F3N3O2 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | (Z)-N-[1-(2-amino-2-oxoethyl)piperidin-4-yl]-3-[4-(trifluoromethyl)phenyl]but-2-enamide |
| SMILES | C/C(=C/C(=O)NC1CCN(CC(N)=O)CC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H22F3N3O2/c1-12(13-2-4-14(5-3-13)18(19,20)21)10-17(26)23-15-6-8-24(9-7-15)11-16(22)25/h2-5,10,15H,6-9,11H2,1H3,(H2,22,25)(H,23,26)/b12-10- |
| InChIKey | TYTQUXXKAVCLLE-BENRWUELSA-N |
| XLogP | 2.17 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|