C18H24ClN3O2 — CID 97464288
(E)-3-(2-chlorophenyl)-N-[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]but-2-enamide (PubChem CID 97464288) has the molecular formula C18H24ClN3O2 and a molecular weight of 349.86 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]but-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]but-2-enamide |
|---|---|
| PubChem CID | 97464288 |
| Molecular Formula | C18H24ClN3O2 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[1-[2-(methylamino)-2-oxoethyl]piperidin-4-yl]but-2-enamide |
| SMILES | CNC(=O)CN1CCC(NC(=O)/C=C(\C)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C18H24ClN3O2/c1-13(15-5-3-4-6-16(15)19)11-17(23)21-14-7-9-22(10-8-14)12-18(24)20-2/h3-6,11,14H,7-10,12H2,1-2H3,(H,20,24)(H,21,23)/b13-11+ |
| InChIKey | RAPGKHWAZOUPCD-ACCUITESSA-N |
| XLogP | 2.07 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|