C15H14F3N3O — CID 51100715
(Z)-N-(1H-pyrazol-5-ylmethyl)-3-[4-(trifluoromethyl)phenyl]but-2-enamide (PubChem CID 51100715) has the molecular formula C15H14F3N3O and a molecular weight of 309.29 g/mol. Its IUPAC name is (Z)-N-(1H-pyrazol-5-ylmethyl)-3-[4-(trifluoromethyl)phenyl]but-2-enamide.
| Compound Name | (Z)-N-(1H-pyrazol-5-ylmethyl)-3-[4-(trifluoromethyl)phenyl]but-2-enamide |
|---|---|
| PubChem CID | 51100715 |
| Molecular Formula | C15H14F3N3O |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | (Z)-N-(1H-pyrazol-5-ylmethyl)-3-[4-(trifluoromethyl)phenyl]but-2-enamide |
| SMILES | C/C(=C/C(=O)NCc1ccn[nH]1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H14F3N3O/c1-10(8-14(22)19-9-13-6-7-20-21-13)11-2-4-12(5-3-11)15(16,17)18/h2-8H,9H2,1H3,(H,19,22)(H,20,21)/b10-8- |
| InChIKey | TVQPSNFZHBZYQU-NTMALXAHSA-N |
| XLogP | 3.15 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|