C18H25N5O4S2 — CID 56536572
4-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]benzamide (PubChem CID 56536572) has the molecular formula C18H25N5O4S2 and a molecular weight of 439.56 g/mol. Its IUPAC name is 4-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]benzamide.
| Compound Name | 4-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 56536572 |
| Molecular Formula | C18H25N5O4S2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 4-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]benzamide |
| SMILES | CC1CN(S(=O)(=O)c2ccc(C(=O)NCCc3n[nH]c(=S)n3C)cc2)CC(C)O1 |
| InChI | InChI=1S/C18H25N5O4S2/c1-12-10-23(11-13(2)27-12)29(25,26)15-6-4-14(5-7-15)17(24)19-9-8-16-20-21-18(28)22(16)3/h4-7,12-13H,8-11H2,1-3H3,(H,19,24)(H,21,28) |
| InChIKey | TUGDKGYWOXHEHK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 109.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|