C13H14ClFN4OS — CID 56801601
2-(2-chloro-6-fluorophenyl)-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]acetamide (PubChem CID 56801601) has the molecular formula C13H14ClFN4OS and a molecular weight of 328.80 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]acetamide.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 56801601 |
| Molecular Formula | C13H14ClFN4OS |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]acetamide |
| SMILES | Cn1c(CCNC(=O)Cc2c(F)cccc2Cl)n[nH]c1=S |
| InChI | InChI=1S/C13H14ClFN4OS/c1-19-11(17-18-13(19)21)5-6-16-12(20)7-8-9(14)3-2-4-10(8)15/h2-4H,5-7H2,1H3,(H,16,20)(H,18,21) |
| InChIKey | VOVVBSRUROTEHB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|