C15H18ClFN2O — CID 107487272
2-(2-chloro-6-fluorophenyl)-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]acetamide (PubChem CID 107487272) has the molecular formula C15H18ClFN2O and a molecular weight of 296.77 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]acetamide.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 107487272 |
| Molecular Formula | C15H18ClFN2O |
| Molecular Weight | 296.77 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]acetamide |
| SMILES | O=C(Cc1c(F)cccc1Cl)NCCC1=CCNCC1 |
| InChI | InChI=1S/C15H18ClFN2O/c16-13-2-1-3-14(17)12(13)10-15(20)19-9-6-11-4-7-18-8-5-11/h1-4,18H,5-10H2,(H,19,20) |
| InChIKey | NDKLWELFIAWPSF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.77 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|