C14H16ClFN2O — CID 107486985
5-chloro-2-fluoro-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]benzamide (PubChem CID 107486985) has the molecular formula C14H16ClFN2O and a molecular weight of 282.75 g/mol. Its IUPAC name is 5-chloro-2-fluoro-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]benzamide.
| Compound Name | 5-chloro-2-fluoro-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 107486985 |
| Molecular Formula | C14H16ClFN2O |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 5-chloro-2-fluoro-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]benzamide |
| SMILES | O=C(NCCC1=CCNCC1)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C14H16ClFN2O/c15-11-1-2-13(16)12(9-11)14(19)18-8-5-10-3-6-17-7-4-10/h1-3,9,17H,4-8H2,(H,18,19) |
| InChIKey | XIMASHCCSXLDMH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|