C21H27N3O3 — CID 54811419
4-[[2-(2,4-dimethylanilino)acetyl]amino]-N-(3-methoxypropyl)benzamide (PubChem CID 54811419) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is 4-[[2-(2,4-dimethylanilino)acetyl]amino]-N-(3-methoxypropyl)benzamide.
| Compound Name | 4-[[2-(2,4-dimethylanilino)acetyl]amino]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 54811419 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 4-[[2-(2,4-dimethylanilino)acetyl]amino]-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCNC(=O)c1ccc(NC(=O)CNc2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C21H27N3O3/c1-15-5-10-19(16(2)13-15)23-14-20(25)24-18-8-6-17(7-9-18)21(26)22-11-4-12-27-3/h5-10,13,23H,4,11-12,14H2,1-3H3,(H,22,26)(H,24,25) |
| InChIKey | YOOZSTKFDSCHKV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|