C19H20Cl3N3O3 — CID 54816310
N-(3-methoxypropyl)-4-[[2-(2,4,5-trichloroanilino)acetyl]amino]benzamide (PubChem CID 54816310) has the molecular formula C19H20Cl3N3O3 and a molecular weight of 444.75 g/mol. Its IUPAC name is N-(3-methoxypropyl)-4-[[2-(2,4,5-trichloroanilino)acetyl]amino]benzamide.
| Compound Name | N-(3-methoxypropyl)-4-[[2-(2,4,5-trichloroanilino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54816310 |
| Molecular Formula | C19H20Cl3N3O3 |
| Molecular Weight | 444.75 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | N-(3-methoxypropyl)-4-[[2-(2,4,5-trichloroanilino)acetyl]amino]benzamide |
| SMILES | COCCCNC(=O)c1ccc(NC(=O)CNc2cc(Cl)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C19H20Cl3N3O3/c1-28-8-2-7-23-19(27)12-3-5-13(6-4-12)25-18(26)11-24-17-10-15(21)14(20)9-16(17)22/h3-6,9-10,24H,2,7-8,11H2,1H3,(H,23,27)(H,25,26) |
| InChIKey | JAZCHKJTZIHXGH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.75 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|