C11H6ClF3N2O2S — CID 62816422
2-chloro-N-(2,4,5-trifluorophenyl)pyridine-3-sulfonamide (PubChem CID 62816422) has the molecular formula C11H6ClF3N2O2S and a molecular weight of 322.70 g/mol. Its IUPAC name is 2-chloro-N-(2,4,5-trifluorophenyl)pyridine-3-sulfonamide.
| Compound Name | 2-chloro-N-(2,4,5-trifluorophenyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62816422 |
| Molecular Formula | C11H6ClF3N2O2S |
| Molecular Weight | 322.70 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | 2-chloro-N-(2,4,5-trifluorophenyl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(F)c(F)cc1F)c1cccnc1Cl |
| InChI | InChI=1S/C11H6ClF3N2O2S/c12-11-10(2-1-3-16-11)20(18,19)17-9-5-7(14)6(13)4-8(9)15/h1-5,17H |
| InChIKey | IURLQOUDQWZXPQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.70 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|