C14H15N3O4S — CID 140517414
2-[(4-ethoxy-3-pyridinyl)sulfamoyl]benzamide (PubChem CID 140517414) has the molecular formula C14H15N3O4S and a molecular weight of 321.36 g/mol. Its IUPAC name is 2-[(4-ethoxy-3-pyridinyl)sulfamoyl]benzamide.
| Compound Name | 2-[(4-ethoxy-3-pyridinyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 140517414 |
| Molecular Formula | C14H15N3O4S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 2-[(4-ethoxy-3-pyridinyl)sulfamoyl]benzamide |
| SMILES | CCOc1ccncc1NS(=O)(=O)c1ccccc1C(N)=O |
| InChI | InChI=1S/C14H15N3O4S/c1-2-21-12-7-8-16-9-11(12)17-22(19,20)13-6-4-3-5-10(13)14(15)18/h3-9,17H,2H2,1H3,(H2,15,18) |
| InChIKey | ABJLYUADHHTSOL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |