C13H20N2O5S — CID 122069871
(2S,3S)-2-[(4-ethoxy-3-pyridinyl)sulfonylamino]-3-methylpentanoic acid (PubChem CID 122069871) has the molecular formula C13H20N2O5S and a molecular weight of 316.38 g/mol. Its IUPAC name is (2S,3S)-2-[(4-ethoxy-3-pyridinyl)sulfonylamino]-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-[(4-ethoxy-3-pyridinyl)sulfonylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 122069871 |
| Molecular Formula | C13H20N2O5S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (2S,3S)-2-[(4-ethoxy-3-pyridinyl)sulfonylamino]-3-methylpentanoic acid |
| SMILES | CCOc1ccncc1S(=O)(=O)NC(C(=O)O)[C@@H](C)CC |
| InChI | InChI=1S/C13H20N2O5S/c1-4-9(3)12(13(16)17)15-21(18,19)11-8-14-7-6-10(11)20-5-2/h6-9,12,15H,4-5H2,1-3H3,(H,16,17)/t9-,12?/m0/s1 |
| InChIKey | KXAMIUKACAHLIF-QHGLUPRGSA-N |
| XLogP | 1.26 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |