C17H15N3O3S3 — CID 2974593
2-methylsulfanyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]benzamide (PubChem CID 2974593) has the molecular formula C17H15N3O3S3 and a molecular weight of 405.53 g/mol. Its IUPAC name is 2-methylsulfanyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]benzamide.
| Compound Name | 2-methylsulfanyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 2974593 |
| Molecular Formula | C17H15N3O3S3 |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | 2-methylsulfanyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]benzamide |
| SMILES | CSc1ccccc1C(=O)Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C17H15N3O3S3/c1-24-15-5-3-2-4-14(15)16(21)19-12-6-8-13(9-7-12)26(22,23)20-17-18-10-11-25-17/h2-11H,1H3,(H,18,20)(H,19,21) |
| InChIKey | CQSFPBDUSNVLFL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |