C10H7BrFN3O4S — CID 63565423
5-bromo-2-fluoro-3-(1H-imidazol-2-ylsulfamoyl)benzoic acid (PubChem CID 63565423) has the molecular formula C10H7BrFN3O4S and a molecular weight of 364.15 g/mol. Its IUPAC name is 5-bromo-2-fluoro-3-(1H-imidazol-2-ylsulfamoyl)benzoic acid.
| Compound Name | 5-bromo-2-fluoro-3-(1H-imidazol-2-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 63565423 |
| Molecular Formula | C10H7BrFN3O4S |
| Molecular Weight | 364.15 g/mol |
| Exact Mass | 362.93 |
| IUPAC Name | 5-bromo-2-fluoro-3-(1H-imidazol-2-ylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1cc(Br)cc(S(=O)(=O)Nc2ncc[nH]2)c1F |
| InChI | InChI=1S/C10H7BrFN3O4S/c11-5-3-6(9(16)17)8(12)7(4-5)20(18,19)15-10-13-1-2-14-10/h1-4H,(H,16,17)(H2,13,14,15) |
| InChIKey | MZRGNRULLKIEFA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.15 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |