C12H16N2O5S — CID 81470671
3-amino-4-(3-hydroxypiperidin-1-yl)sulfonylbenzoic acid (PubChem CID 81470671) has the molecular formula C12H16N2O5S and a molecular weight of 300.34 g/mol. Its IUPAC name is 3-amino-4-(3-hydroxypiperidin-1-yl)sulfonylbenzoic acid.
| Compound Name | 3-amino-4-(3-hydroxypiperidin-1-yl)sulfonylbenzoic acid |
|---|---|
| PubChem CID | 81470671 |
| Molecular Formula | C12H16N2O5S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 3-amino-4-(3-hydroxypiperidin-1-yl)sulfonylbenzoic acid |
| SMILES | Nc1cc(C(=O)O)ccc1S(=O)(=O)N1CCCC(O)C1 |
| InChI | InChI=1S/C12H16N2O5S/c13-10-6-8(12(16)17)3-4-11(10)20(18,19)14-5-1-2-9(15)7-14/h3-4,6,9,15H,1-2,5,7,13H2,(H,16,17) |
| InChIKey | MHAYXFMYCVQPPZ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|