C12H16N2O3 — CID 82785315
4-amino-3-(3-hydroxypiperidin-1-yl)benzoic acid (PubChem CID 82785315) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 4-amino-3-(3-hydroxypiperidin-1-yl)benzoic acid.
| Compound Name | 4-amino-3-(3-hydroxypiperidin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 82785315 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 4-amino-3-(3-hydroxypiperidin-1-yl)benzoic acid |
| SMILES | Nc1ccc(C(=O)O)cc1N1CCCC(O)C1 |
| InChI | InChI=1S/C12H16N2O3/c13-10-4-3-8(12(16)17)6-11(10)14-5-1-2-9(15)7-14/h3-4,6,9,15H,1-2,5,7,13H2,(H,16,17) |
| InChIKey | QNZFUCDXWBHUCM-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|