C12H15BrClFN2O2S — CID 120777102
[1-(4-bromo-5-chloro-2-fluorophenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine (PubChem CID 120777102) has the molecular formula C12H15BrClFN2O2S and a molecular weight of 385.69 g/mol. Its IUPAC name is [1-(4-bromo-5-chloro-2-fluorophenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine.
| Compound Name | [1-(4-bromo-5-chloro-2-fluorophenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 120777102 |
| Molecular Formula | C12H15BrClFN2O2S |
| Molecular Weight | 385.69 g/mol |
| Exact Mass | 383.97 |
| IUPAC Name | [1-(4-bromo-5-chloro-2-fluorophenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine |
| SMILES | CC1(CN)CCN(S(=O)(=O)c2cc(Cl)c(Br)cc2F)C1 |
| InChI | InChI=1S/C12H15BrClFN2O2S/c1-12(6-16)2-3-17(7-12)20(18,19)11-5-9(14)8(13)4-10(11)15/h4-5H,2-3,6-7,16H2,1H3 |
| InChIKey | UQLLVDANIDDQKG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.69 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|