C12H16BrClF2N2O2S — CID 120778017
[1-(5-bromo-2,4-difluorophenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 120778017) has the molecular formula C12H16BrClF2N2O2S and a molecular weight of 405.69 g/mol. Its IUPAC name is [1-(5-bromo-2,4-difluorophenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine;hydrochloride.
| Compound Name | [1-(5-bromo-2,4-difluorophenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120778017 |
| Molecular Formula | C12H16BrClF2N2O2S |
| Molecular Weight | 405.69 g/mol |
| Exact Mass | 403.98 |
| IUPAC Name | [1-(5-bromo-2,4-difluorophenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | CC1(CN)CCN(S(=O)(=O)c2cc(Br)c(F)cc2F)C1.Cl |
| InChI | InChI=1S/C12H15BrF2N2O2S.ClH/c1-12(6-16)2-3-17(7-12)20(18,19)11-4-8(13)9(14)5-10(11)15;/h4-5H,2-3,6-7,16H2,1H3;1H |
| InChIKey | NVGSIUVHEKUPAB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.69 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|