C12H17BrCl2N2O2S — CID 120777267
[1-(5-bromo-2-chlorophenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 120777267) has the molecular formula C12H17BrCl2N2O2S and a molecular weight of 404.16 g/mol. Its IUPAC name is [1-(5-bromo-2-chlorophenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine;hydrochloride.
| Compound Name | [1-(5-bromo-2-chlorophenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120777267 |
| Molecular Formula | C12H17BrCl2N2O2S |
| Molecular Weight | 404.16 g/mol |
| Exact Mass | 401.96 |
| IUPAC Name | [1-(5-bromo-2-chlorophenyl)sulfonyl-3-methylpyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | CC1(CN)CCN(S(=O)(=O)c2cc(Br)ccc2Cl)C1.Cl |
| InChI | InChI=1S/C12H16BrClN2O2S.ClH/c1-12(7-15)4-5-16(8-12)19(17,18)11-6-9(13)2-3-10(11)14;/h2-3,6H,4-5,7-8,15H2,1H3;1H |
| InChIKey | NYNQHHNBWNSDEZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.16 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |