C13H17ClN2O3S2 — CID 80694525
4-chloro-3-(2,2-dimethylmorpholin-4-yl)sulfonylbenzenecarbothioamide (PubChem CID 80694525) has the molecular formula C13H17ClN2O3S2 and a molecular weight of 348.88 g/mol. Its IUPAC name is 4-chloro-3-(2,2-dimethylmorpholin-4-yl)sulfonylbenzenecarbothioamide.
| Compound Name | 4-chloro-3-(2,2-dimethylmorpholin-4-yl)sulfonylbenzenecarbothioamide |
|---|---|
| PubChem CID | 80694525 |
| Molecular Formula | C13H17ClN2O3S2 |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 4-chloro-3-(2,2-dimethylmorpholin-4-yl)sulfonylbenzenecarbothioamide |
| SMILES | CC1(C)CN(S(=O)(=O)c2cc(C(N)=S)ccc2Cl)CCO1 |
| InChI | InChI=1S/C13H17ClN2O3S2/c1-13(2)8-16(5-6-19-13)21(17,18)11-7-9(12(15)20)3-4-10(11)14/h3-4,7H,5-6,8H2,1-2H3,(H2,15,20) |
| InChIKey | IWWDRBXDRMJXHX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|