C12H16BrClN2O2S — CID 120999452
[1-(3-bromo-2-chlorophenyl)sulfonylpiperidin-4-yl]methanamine (PubChem CID 120999452) has the molecular formula C12H16BrClN2O2S and a molecular weight of 367.70 g/mol. Its IUPAC name is [1-(3-bromo-2-chlorophenyl)sulfonylpiperidin-4-yl]methanamine.
| Compound Name | [1-(3-bromo-2-chlorophenyl)sulfonylpiperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 120999452 |
| Molecular Formula | C12H16BrClN2O2S |
| Molecular Weight | 367.70 g/mol |
| Exact Mass | 365.98 |
| IUPAC Name | [1-(3-bromo-2-chlorophenyl)sulfonylpiperidin-4-yl]methanamine |
| SMILES | NCC1CCN(S(=O)(=O)c2cccc(Br)c2Cl)CC1 |
| InChI | InChI=1S/C12H16BrClN2O2S/c13-10-2-1-3-11(12(10)14)19(17,18)16-6-4-9(8-15)5-7-16/h1-3,9H,4-8,15H2 |
| InChIKey | UERVVPUYGHWPQD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.70 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |