C21H25F2N3O4S — CID 126511190
tert-butyl 4-[4-(difluoromethyl)isoquinolin-5-yl]sulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1-carboxylate (PubChem CID 126511190) has the molecular formula C21H25F2N3O4S and a molecular weight of 453.51 g/mol. Its IUPAC name is tert-butyl 4-[4-(difluoromethyl)isoquinolin-5-yl]sulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(difluoromethyl)isoquinolin-5-yl]sulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 126511190 |
| Molecular Formula | C21H25F2N3O4S |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | tert-butyl 4-[4-(difluoromethyl)isoquinolin-5-yl]sulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2C1CCN2S(=O)(=O)c1cccc2cncc(C(F)F)c12 |
| InChI | InChI=1S/C21H25F2N3O4S/c1-21(2,3)30-20(27)25-9-7-16-15(25)8-10-26(16)31(28,29)17-6-4-5-13-11-24-12-14(18(13)17)19(22)23/h4-6,11-12,15-16,19H,7-10H2,1-3H3 |
| InChIKey | UJASBSNXLZGWLD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |