C23H28ClN3O3 — CID 166200909
tert-butyl N-[[4-[[1-(4-chlorophenyl)pyrrolidin-3-yl]carbamoyl]phenyl]methyl]carbamate (PubChem CID 166200909) has the molecular formula C23H28ClN3O3 and a molecular weight of 429.95 g/mol. Its IUPAC name is tert-butyl N-[[4-[[1-(4-chlorophenyl)pyrrolidin-3-yl]carbamoyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[[1-(4-chlorophenyl)pyrrolidin-3-yl]carbamoyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 166200909 |
| Molecular Formula | C23H28ClN3O3 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | tert-butyl N-[[4-[[1-(4-chlorophenyl)pyrrolidin-3-yl]carbamoyl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(C(=O)NC2CCN(c3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C23H28ClN3O3/c1-23(2,3)30-22(29)25-14-16-4-6-17(7-5-16)21(28)26-19-12-13-27(15-19)20-10-8-18(24)9-11-20/h4-11,19H,12-15H2,1-3H3,(H,25,29)(H,26,28) |
| InChIKey | XNLLHASTKTUFNX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |