C22H29F3N2O4 — CID 158550488
ethane;N-hydroxy-2,2-dimethyl-3-[methyl-[[4-[4-(trifluoromethoxy)phenoxy]phenyl]methyl]amino]propanamide (PubChem CID 158550488) has the molecular formula C22H29F3N2O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is ethane;N-hydroxy-2,2-dimethyl-3-[methyl-[[4-[4-(trifluoromethoxy)phenoxy]phenyl]methyl]amino]propanamide.
| Compound Name | ethane;N-hydroxy-2,2-dimethyl-3-[methyl-[[4-[4-(trifluoromethoxy)phenoxy]phenyl]methyl]amino]propanamide |
|---|---|
| PubChem CID | 158550488 |
| Molecular Formula | C22H29F3N2O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | ethane;N-hydroxy-2,2-dimethyl-3-[methyl-[[4-[4-(trifluoromethoxy)phenoxy]phenyl]methyl]amino]propanamide |
| SMILES | CC.CN(Cc1ccc(Oc2ccc(OC(F)(F)F)cc2)cc1)CC(C)(C)C(=O)NO |
| InChI | InChI=1S/C20H23F3N2O4.C2H6/c1-19(2,18(26)24-27)13-25(3)12-14-4-6-15(7-5-14)28-16-8-10-17(11-9-16)29-20(21,22)23;1-2/h4-11,27H,12-13H2,1-3H3,(H,24,26);1-2H3 |
| InChIKey | HPQRRMXILJRZQT-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|