C20H20FN3O6S — CID 88880289
(2R)-4-[5-fluoro-4-[4-(1,3-oxazol-2-yl)phenyl]-2-oxo-1-pyridinyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (PubChem CID 88880289) has the molecular formula C20H20FN3O6S and a molecular weight of 449.46 g/mol. Its IUPAC name is (2R)-4-[5-fluoro-4-[4-(1,3-oxazol-2-yl)phenyl]-2-oxo-1-pyridinyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | (2R)-4-[5-fluoro-4-[4-(1,3-oxazol-2-yl)phenyl]-2-oxo-1-pyridinyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 88880289 |
| Molecular Formula | C20H20FN3O6S |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | (2R)-4-[5-fluoro-4-[4-(1,3-oxazol-2-yl)phenyl]-2-oxo-1-pyridinyl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| SMILES | C[C@@](CCn1cc(F)c(-c2ccc(-c3ncco3)cc2)cc1=O)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C20H20FN3O6S/c1-20(19(26)23-27,31(2,28)29)7-9-24-12-16(21)15(11-17(24)25)13-3-5-14(6-4-13)18-22-8-10-30-18/h3-6,8,10-12,27H,7,9H2,1-2H3,(H,23,26)/t20-/m1/s1 |
| InChIKey | JGIDAEUYFXZQGY-HXUWFJFHSA-N |
| XLogP | 2.01 |
| TPSA | 131.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|