C20H22FN3O5S — CID 118174860
(2R)-4-[5-(2-fluoro-4-methoxyphenyl)indazol-1-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (PubChem CID 118174860) has the molecular formula C20H22FN3O5S and a molecular weight of 435.48 g/mol. Its IUPAC name is (2R)-4-[5-(2-fluoro-4-methoxyphenyl)indazol-1-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | (2R)-4-[5-(2-fluoro-4-methoxyphenyl)indazol-1-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 118174860 |
| Molecular Formula | C20H22FN3O5S |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | (2R)-4-[5-(2-fluoro-4-methoxyphenyl)indazol-1-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| SMILES | COc1ccc(-c2ccc3c(cnn3CC[C@](C)(C(=O)NO)S(C)(=O)=O)c2)c(F)c1 |
| InChI | InChI=1S/C20H22FN3O5S/c1-20(19(25)23-26,30(3,27)28)8-9-24-18-7-4-13(10-14(18)12-22-24)16-6-5-15(29-2)11-17(16)21/h4-7,10-12,26H,8-9H2,1-3H3,(H,23,25)/t20-/m1/s1 |
| InChIKey | GUGAXZMFRJXXIZ-HXUWFJFHSA-N |
| XLogP | 2.55 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|