C21H22N4O4S — CID 118174829
(2S)-4-[5-[2-(4-aminophenyl)ethynyl]indazol-1-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (PubChem CID 118174829) has the molecular formula C21H22N4O4S and a molecular weight of 426.50 g/mol. Its IUPAC name is (2S)-4-[5-[2-(4-aminophenyl)ethynyl]indazol-1-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | (2S)-4-[5-[2-(4-aminophenyl)ethynyl]indazol-1-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 118174829 |
| Molecular Formula | C21H22N4O4S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | (2S)-4-[5-[2-(4-aminophenyl)ethynyl]indazol-1-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| SMILES | C[C@](CCn1ncc2cc(C#Cc3ccc(N)cc3)ccc21)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C21H22N4O4S/c1-21(20(26)24-27,30(2,28)29)11-12-25-19-10-7-16(13-17(19)14-23-25)4-3-15-5-8-18(22)9-6-15/h5-10,13-14,27H,11-12,22H2,1-2H3,(H,24,26)/t21-/m0/s1 |
| InChIKey | STZVFCYYKFGSBR-NRFANRHFSA-N |
| XLogP | 1.72 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|