C21H22N2O6S — CID 118174831
(2R)-N-hydroxy-4-[5-[4-(3-hydroxyoxetan-3-yl)buta-1,3-diynyl]indol-1-yl]-2-methyl-2-methylsulfonylbutanamide (PubChem CID 118174831) has the molecular formula C21H22N2O6S and a molecular weight of 430.48 g/mol. Its IUPAC name is (2R)-N-hydroxy-4-[5-[4-(3-hydroxyoxetan-3-yl)buta-1,3-diynyl]indol-1-yl]-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | (2R)-N-hydroxy-4-[5-[4-(3-hydroxyoxetan-3-yl)buta-1,3-diynyl]indol-1-yl]-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 118174831 |
| Molecular Formula | C21H22N2O6S |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | (2R)-N-hydroxy-4-[5-[4-(3-hydroxyoxetan-3-yl)buta-1,3-diynyl]indol-1-yl]-2-methyl-2-methylsulfonylbutanamide |
| SMILES | C[C@@](CCn1ccc2cc(C#CC#CC3(O)COC3)ccc21)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C21H22N2O6S/c1-20(19(24)22-26,30(2,27)28)10-12-23-11-8-17-13-16(6-7-18(17)23)5-3-4-9-21(25)14-29-15-21/h6-8,11,13,25-26H,10,12,14-15H2,1-2H3,(H,22,24)/t20-/m1/s1 |
| InChIKey | CELXYXYLZCGYFY-HXUWFJFHSA-N |
| XLogP | 0.46 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|