C26H28N2O4S — CID 118174825
4-[5-[2-[4-[(1S,2S)-2-(hydroxymethyl)cyclopropyl]phenyl]ethynyl]indol-1-yl]-2-methyl-2-methylsulfonylbutanamide (PubChem CID 118174825) has the molecular formula C26H28N2O4S and a molecular weight of 464.59 g/mol. Its IUPAC name is 4-[5-[2-[4-[(1S,2S)-2-(hydroxymethyl)cyclopropyl]phenyl]ethynyl]indol-1-yl]-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | 4-[5-[2-[4-[(1S,2S)-2-(hydroxymethyl)cyclopropyl]phenyl]ethynyl]indol-1-yl]-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 118174825 |
| Molecular Formula | C26H28N2O4S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 4-[5-[2-[4-[(1S,2S)-2-(hydroxymethyl)cyclopropyl]phenyl]ethynyl]indol-1-yl]-2-methyl-2-methylsulfonylbutanamide |
| SMILES | CC(CCn1ccc2cc(C#Cc3ccc([C@H]4C[C@@H]4CO)cc3)ccc21)(C(N)=O)S(C)(=O)=O |
| InChI | InChI=1S/C26H28N2O4S/c1-26(25(27)30,33(2,31)32)12-14-28-13-11-21-15-19(7-10-24(21)28)4-3-18-5-8-20(9-6-18)23-16-22(23)17-29/h5-11,13,15,22-23,29H,12,14,16-17H2,1-2H3,(H2,27,30)/t22-,23-,26?/m1/s1 |
| InChIKey | OJZQUWWGOLXFQK-JIISWEIGSA-N |
| XLogP | 2.82 |
| TPSA | 102.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|