C31H34N6O8S — CID 175833599
2-methyl-2-methylsulfonyl-4-[4-[4-[1-[(4-nitrophenyl)methyl]triazol-4-yl]phenyl]-2-oxo-1-pyridinyl]-N-(oxan-2-yloxy)butanamide (PubChem CID 175833599) has the molecular formula C31H34N6O8S and a molecular weight of 650.71 g/mol. Its IUPAC name is 2-methyl-2-methylsulfonyl-4-[4-[4-[1-[(4-nitrophenyl)methyl]triazol-4-yl]phenyl]-2-oxo-1-pyridinyl]-N-(oxan-2-yloxy)butanamide.
| Compound Name | 2-methyl-2-methylsulfonyl-4-[4-[4-[1-[(4-nitrophenyl)methyl]triazol-4-yl]phenyl]-2-oxo-1-pyridinyl]-N-(oxan-2-yloxy)butanamide |
|---|---|
| PubChem CID | 175833599 |
| Molecular Formula | C31H34N6O8S |
| Molecular Weight | 650.71 g/mol |
| Exact Mass | 650.22 |
| IUPAC Name | 2-methyl-2-methylsulfonyl-4-[4-[4-[1-[(4-nitrophenyl)methyl]triazol-4-yl]phenyl]-2-oxo-1-pyridinyl]-N-(oxan-2-yloxy)butanamide |
| SMILES | CC(CCn1ccc(-c2ccc(-c3cn(Cc4ccc([N+](=O)[O-])cc4)nn3)cc2)cc1=O)(C(=O)NOC1CCCCO1)S(C)(=O)=O |
| InChI | InChI=1S/C31H34N6O8S/c1-31(46(2,42)43,30(39)33-45-29-5-3-4-18-44-29)15-17-35-16-14-25(19-28(35)38)23-8-10-24(11-9-23)27-21-36(34-32-27)20-22-6-12-26(13-7-22)37(40)41/h6-14,16,19,21,29H,3-5,15,17-18,20H2,1-2H3,(H,33,39) |
| InChIKey | GAMBZLZAUVZVDB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 177.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.71 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|