C25H26N6O5S — CID 167459027
N-hydroxy-2-methyl-2-methylsulfonyl-4-[2-oxo-4-[4-[1-(pyridin-4-ylmethyl)triazol-4-yl]phenyl]-1-pyridinyl]butanamide (PubChem CID 167459027) has the molecular formula C25H26N6O5S and a molecular weight of 522.59 g/mol. Its IUPAC name is N-hydroxy-2-methyl-2-methylsulfonyl-4-[2-oxo-4-[4-[1-(pyridin-4-ylmethyl)triazol-4-yl]phenyl]-1-pyridinyl]butanamide.
| Compound Name | N-hydroxy-2-methyl-2-methylsulfonyl-4-[2-oxo-4-[4-[1-(pyridin-4-ylmethyl)triazol-4-yl]phenyl]-1-pyridinyl]butanamide |
|---|---|
| PubChem CID | 167459027 |
| Molecular Formula | C25H26N6O5S |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | N-hydroxy-2-methyl-2-methylsulfonyl-4-[2-oxo-4-[4-[1-(pyridin-4-ylmethyl)triazol-4-yl]phenyl]-1-pyridinyl]butanamide |
| SMILES | CC(CCn1ccc(-c2ccc(-c3cn(Cc4ccncc4)nn3)cc2)cc1=O)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C25H26N6O5S/c1-25(24(33)28-34,37(2,35)36)10-14-30-13-9-21(15-23(30)32)19-3-5-20(6-4-19)22-17-31(29-27-22)16-18-7-11-26-12-8-18/h3-9,11-13,15,17,34H,10,14,16H2,1-2H3,(H,28,33) |
| InChIKey | WHGMJARADUCKCJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 149.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|