C26H32BO5 — CID 158567872
CID 158567872 (PubChem CID 158567872) has the molecular formula C26H32BO5 and a molecular weight of 435.35 g/mol.
| Compound Name | CID 158567872 |
|---|---|
| PubChem CID | 158567872 |
| Molecular Formula | C26H32BO5 |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | — |
| SMILES | C[C@@](COC1CCCCO1)(CC(C[B]C=O)Cc1ccc(-c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C26H32BO5/c1-26(25(29)30,18-32-24-9-5-6-14-31-24)16-21(17-27-19-28)15-20-10-12-23(13-11-20)22-7-3-2-4-8-22/h2-4,7-8,10-13,19,21,24H,5-6,9,14-18H2,1H3,(H,29,30)/t21?,24?,26-/m0/s1 |
| InChIKey | TYEPUTOLZBDWID-QVKCHMKDSA-N |
| XLogP | 4.85 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|