C24H31ClFNO3 — CID 139484110
ethyl (2S,4R)-4-amino-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-(2-ethoxyethyl)-2-methylpentanoate (PubChem CID 139484110) has the molecular formula C24H31ClFNO3 and a molecular weight of 435.97 g/mol. Its IUPAC name is ethyl (2S,4R)-4-amino-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-(2-ethoxyethyl)-2-methylpentanoate.
| Compound Name | ethyl (2S,4R)-4-amino-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-(2-ethoxyethyl)-2-methylpentanoate |
|---|---|
| PubChem CID | 139484110 |
| Molecular Formula | C24H31ClFNO3 |
| Molecular Weight | 435.97 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | ethyl (2S,4R)-4-amino-5-[4-(5-chloro-2-fluorophenyl)phenyl]-2-(2-ethoxyethyl)-2-methylpentanoate |
| SMILES | CCOCC[C@](C)(C[C@H](N)Cc1ccc(-c2cc(Cl)ccc2F)cc1)C(=O)OCC |
| InChI | InChI=1S/C24H31ClFNO3/c1-4-29-13-12-24(3,23(28)30-5-2)16-20(27)14-17-6-8-18(9-7-17)21-15-19(25)10-11-22(21)26/h6-11,15,20H,4-5,12-14,16,27H2,1-3H3/t20-,24-/m1/s1 |
| InChIKey | AFUIYALJZIHASV-HYBUGGRVSA-N |
| XLogP | 5.40 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.97 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|