C19H21ClFNO2 — CID 149101647
ethyl (3R)-3-amino-5-[4-(5-chloro-2-fluorophenyl)phenyl]pentanoate (PubChem CID 149101647) has the molecular formula C19H21ClFNO2 and a molecular weight of 349.83 g/mol. Its IUPAC name is ethyl (3R)-3-amino-5-[4-(5-chloro-2-fluorophenyl)phenyl]pentanoate.
| Compound Name | ethyl (3R)-3-amino-5-[4-(5-chloro-2-fluorophenyl)phenyl]pentanoate |
|---|---|
| PubChem CID | 149101647 |
| Molecular Formula | C19H21ClFNO2 |
| Molecular Weight | 349.83 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | ethyl (3R)-3-amino-5-[4-(5-chloro-2-fluorophenyl)phenyl]pentanoate |
| SMILES | CCOC(=O)C[C@H](N)CCc1ccc(-c2cc(Cl)ccc2F)cc1 |
| InChI | InChI=1S/C19H21ClFNO2/c1-2-24-19(23)12-16(22)9-5-13-3-6-14(7-4-13)17-11-15(20)8-10-18(17)21/h3-4,6-8,10-11,16H,2,5,9,12,22H2,1H3/t16-/m1/s1 |
| InChIKey | QUSZXWSYUFEDKL-MRXNPFEDSA-N |
| XLogP | 4.36 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.83 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |