C21H24ClFN4O3 — CID 135209078
(4R)-4-amino-2-(2-azidoethyl)-6-[4-(5-chloro-2-fluorophenyl)phenyl]-2-(hydroxymethyl)hexanoic acid (PubChem CID 135209078) has the molecular formula C21H24ClFN4O3 and a molecular weight of 434.90 g/mol. Its IUPAC name is (4R)-4-amino-2-(2-azidoethyl)-6-[4-(5-chloro-2-fluorophenyl)phenyl]-2-(hydroxymethyl)hexanoic acid.
| Compound Name | (4R)-4-amino-2-(2-azidoethyl)-6-[4-(5-chloro-2-fluorophenyl)phenyl]-2-(hydroxymethyl)hexanoic acid |
|---|---|
| PubChem CID | 135209078 |
| Molecular Formula | C21H24ClFN4O3 |
| Molecular Weight | 434.90 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | (4R)-4-amino-2-(2-azidoethyl)-6-[4-(5-chloro-2-fluorophenyl)phenyl]-2-(hydroxymethyl)hexanoic acid |
| SMILES | [N-]=[N+]=NCCC(CO)(C[C@H](N)CCc1ccc(-c2cc(Cl)ccc2F)cc1)C(=O)O |
| InChI | InChI=1S/C21H24ClFN4O3/c22-16-6-8-19(23)18(11-16)15-4-1-14(2-5-15)3-7-17(24)12-21(13-28,20(29)30)9-10-26-27-25/h1-2,4-6,8,11,17,28H,3,7,9-10,12-13,24H2,(H,29,30)/t17-,21?/m1/s1 |
| InChIKey | ZAWLSROKQQTTAW-OQHSHRKDSA-N |
| XLogP | 4.56 |
| TPSA | 132.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.90 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|