C21H23ClFNO3 — CID 118279808
(2R)-2-[2-amino-3-[2-chloro-4-(2-fluorophenyl)phenyl]propyl]-2-(hydroxymethyl)pent-4-enoic acid (PubChem CID 118279808) has the molecular formula C21H23ClFNO3 and a molecular weight of 391.87 g/mol. Its IUPAC name is (2R)-2-[2-amino-3-[2-chloro-4-(2-fluorophenyl)phenyl]propyl]-2-(hydroxymethyl)pent-4-enoic acid.
| Compound Name | (2R)-2-[2-amino-3-[2-chloro-4-(2-fluorophenyl)phenyl]propyl]-2-(hydroxymethyl)pent-4-enoic acid |
|---|---|
| PubChem CID | 118279808 |
| Molecular Formula | C21H23ClFNO3 |
| Molecular Weight | 391.87 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | (2R)-2-[2-amino-3-[2-chloro-4-(2-fluorophenyl)phenyl]propyl]-2-(hydroxymethyl)pent-4-enoic acid |
| SMILES | C=CC[C@](CO)(CC(N)Cc1ccc(-c2ccccc2F)cc1Cl)C(=O)O |
| InChI | InChI=1S/C21H23ClFNO3/c1-2-9-21(13-25,20(26)27)12-16(24)10-15-8-7-14(11-18(15)22)17-5-3-4-6-19(17)23/h2-8,11,16,25H,1,9-10,12-13,24H2,(H,26,27)/t16?,21-/m1/s1 |
| InChIKey | VSBKXPBENIBISD-CAWMZFRYSA-N |
| XLogP | 4.05 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.87 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|