C17H17ClFNO2 — CID 156767959
ethyl 3-[4-(2-amino-5-chloro-3-fluorophenyl)phenyl]propanoate (PubChem CID 156767959) has the molecular formula C17H17ClFNO2 and a molecular weight of 321.78 g/mol. Its IUPAC name is ethyl 3-[4-(2-amino-5-chloro-3-fluorophenyl)phenyl]propanoate.
| Compound Name | ethyl 3-[4-(2-amino-5-chloro-3-fluorophenyl)phenyl]propanoate |
|---|---|
| PubChem CID | 156767959 |
| Molecular Formula | C17H17ClFNO2 |
| Molecular Weight | 321.78 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | ethyl 3-[4-(2-amino-5-chloro-3-fluorophenyl)phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(-c2cc(Cl)cc(F)c2N)cc1 |
| InChI | InChI=1S/C17H17ClFNO2/c1-2-22-16(21)8-5-11-3-6-12(7-4-11)14-9-13(18)10-15(19)17(14)20/h3-4,6-7,9-10H,2,5,8,20H2,1H3 |
| InChIKey | DPZYEVZAVOCHBX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.78 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|