C25H27BClFO3S — CID 158499472
[(2S)-2-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl]-5-ethoxy-5-oxo-4-thiophen-2-ylpentyl]-methylborinic acid (PubChem CID 158499472) has the molecular formula C25H27BClFO3S and a molecular weight of 472.82 g/mol. Its IUPAC name is [(2S)-2-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl]-5-ethoxy-5-oxo-4-thiophen-2-ylpentyl]-methylborinic acid.
| Compound Name | [(2S)-2-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl]-5-ethoxy-5-oxo-4-thiophen-2-ylpentyl]-methylborinic acid |
|---|---|
| PubChem CID | 158499472 |
| Molecular Formula | C25H27BClFO3S |
| Molecular Weight | 472.82 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | [(2S)-2-[[4-(5-chloro-2-fluorophenyl)phenyl]methyl]-5-ethoxy-5-oxo-4-thiophen-2-ylpentyl]-methylborinic acid |
| SMILES | CCOC(=O)C(C[C@H](CB(C)O)Cc1ccc(-c2cc(Cl)ccc2F)cc1)c1cccs1 |
| InChI | InChI=1S/C25H27BClFO3S/c1-3-31-25(29)22(24-5-4-12-32-24)14-18(16-26(2)30)13-17-6-8-19(9-7-17)21-15-20(27)10-11-23(21)28/h4-12,15,18,22,30H,3,13-14,16H2,1-2H3/t18-,22?/m1/s1 |
| InChIKey | HRKOYNBMFHOGLQ-ZZWBGTBQSA-N |
| XLogP | 6.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.82 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|